Identification |
Name: | Tetracosanoic acid |
Synonyms: | FL 88; FL88 (fatty acid); L 88; L 88 (fatty acid); Lignoceric acid; n-Tetracosanoic acid |
CAS: | 557-59-5 |
EINECS: | 209-180-7 |
Molecular Formula: | C24H48 O2 |
Molecular Weight: | 368.64 |
InChI: | InChI=1S/C24H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h2-23H2,1H3,(H,25,26) |
Molecular Structure: |
|
Properties |
Melting Point: | 80-82 °C
|
Flash Point: | 182.2°C |
Boiling Point: | 272 °C10 mm Hg(lit.)
|
Density: | 0.879g/cm3 |
Specification: | white shiny crystalline powder or flakes Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Flash Point: | 182.2°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
|