| Identification | |
| Name: | 5-Benzofuranmethanamine,2,3-dihydro- |
| Synonyms: | (2,3-Dihydrobenzofuran-5-yl)methanamine;5-(Aminomethyl)-2,3-dihydrobenzo[b]furan;5-(Aminomethyl)-2,3-dihydrobenzofuran;5-(Aminomethyl)coumaran;N-[(2,3-Dihydrobenzofuran-5-yl)methyl]amine;[(2,3-Dihydrobenzofuran-5-yl)methyl]amine;1-(2,3-dihydro-1-benzofuran-5-yl)methanamine;5-(AMINOMETHYL)-2,3-DIHYDROBENZO[B]FURAN; |
| CAS: | 55745-74-9 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C9H11NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5H,3-4,6,10H2 |
| Molecular Structure: | ![(C9H11NO) (2,3-Dihydrobenzofuran-5-yl)methanamine;5-(Aminomethyl)-2,3-dihydrobenzo[b]furan;5-(Aminomethyl)-2,3...](https://img1.guidechem.com/chem/e/dict/13/55745-74-9.jpg) |
| Properties | |
| Melting Point: | 251-254°C |
| Flash Point: | 128.7°C |
| Boiling Point: | 98-100/0.1mm |
| Density: | 1.151g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powde Safety Statements:26-36/37/39-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes |
| Flash Point: | 128.7°C |
| Safety Data | |
 |
|
