Identification |
Name: | 1H-Pyrrole-1-aceticacid, 2,5-dihydro-2,5-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester |
Synonyms: | 1H-Pyrrole-2,5-dione,1-[2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl]- (9CI);AMAS;Maleimidoaceticacid N-hydroxysuccinimidyl ester;N-(a-Maleimidoacetoxy)succimide; |
CAS: | 55750-61-3 |
Molecular Formula: | C10H8N2O6 |
Molecular Weight: | 252.18 |
InChI: | InChI=1/C10H8N2O6/c13-6-1-2-7(14)11(6)5-10(17)18-12-8(15)3-4-9(12)16/h1-2H,3-5H2 |
Molecular Structure: |
|
Properties |
Density: | 1.63 g/cm3 |
Refractive index: | 1.619 |
Storage Temperature: | −20°C |
Usage: | A hetero-bifunctional cross-linking reagent for the preparation of protein-protein or protein-hapten conjugates |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|