| Identification | |
| Name: | 3-Furanthiol,2,5-dimethyl- |
| Synonyms: | 2,5-Dimethyl-3-furanthiol;2,5-Dimethyl-3-mercaptofuran;3-Mercapto-2,5-dimethylfuran;2.5-dimethyl-3-furanthiol; |
| CAS: | 55764-23-3 |
| EINECS: | 259-800-5 |
| Molecular Formula: | C6H8OS |
| Molecular Weight: | 128.19 |
| InChI: | InChI=1/C6H8OS/c1-4-3-6(8)5(2)7-4/h3,8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.05 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.505-1.515 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear amber to orange liquid |
| Specification: |
3-Furanthiol,2,5-dimethyl- (CAS NO.55764-23-3), its Synonyms are 2,5-Dimethyl-3-furanthiol ; 2,5-Dimethyl-3-furylmercaptan ; 2,5-Dimethyl-3-mercaptofuran ; 3-Mercapto-2,5-dimethylfuran . |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
