Identification |
Name: | Imidazo[1,2-a]pyrazin-3(7H)-one,6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(phenylmethyl)- |
Synonyms: | Coelenterazin;Coelenterazine; Coelenterazine ntv; Luciferin; Luciferin (Oplophorus);NanoFuel; Native coelenterazine; Preluciferin; Preluciferin (Watasenia);Watasenia preluciferin |
CAS: | 55779-48-1 |
Molecular Formula: | C26H21 N3 O3 |
Molecular Weight: | 423.47 |
InChI: | InChI=1/C26H21N3O3/c30-20-10-6-18(7-11-20)15-23-26(32)29-16-24(19-8-12-21(31)13-9-19)27-22(25(29)28-23)14-17-4-2-1-3-5-17/h1-13,16,27,30-31H,14-15H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 341.7°C |
Boiling Point: | 641.4°Cat760mmHg |
Density: | 1.32g/cm3 |
Refractive index: | 1.688 |
Specification: |
Coelenteramine (CAS No.55779-48-1), its synonyms are 2-[(4-Hydroxyphenyl)methyl]-6-(4-hydroxyphenyl)-8-(phenylmethyl)-imdazo[1,2-a]pyrazin-3-(7H)-one ; 8-Benzyl-2-(4-hydroxybenzyl)-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one .
|
Flash Point: | 341.7°C |
Storage Temperature: | −20°C |
Color: | yellow |
Usage: | A luminophore of the aequorin complex which is oxidized by oxygen to illuminate at 465nm when Ca2+ binds to the complex. Used to measure Ca2+ concentration in cells with high sensitivity an dlarge dynamic range |
Safety Data |
|
|