Identification |
Name: | 1-Butanone,4-(1-pyrrolidinyl)-1-(2,4,6-trimethoxyphenyl)- |
Synonyms: | (2,4,6-Trimethoxyphenyl) (3-Pyrrolidinopropyl) Ketone;4-(1-Pyrrolidinyl)-1-(2,4,6-trimethoxyphenyl)-1-butanone;4-(Pyrrolidin-1-yl)-1-(2,4,6-trimethoxyphenyl)butan-1-one;4-pyrrolidin-1-yl-1-[2,4,6-tris(methyloxy)phenyl]butan-1-one; |
CAS: | 55837-25-7 |
EINECS: | 259-851-3 |
Molecular Formula: | C17H25NO4 |
Molecular Weight: | 307.39 |
InChI: | InChI=1/C17H25NO4/c1-20-13-11-15(21-2)17(16(12-13)22-3)14(19)7-6-10-18-8-4-5-9-18/h11-12H,4-10H2,1-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 228.7°C |
Boiling Point: | 454.5°Cat760mmHg |
Density: | 1.09g/cm3 |
Refractive index: | 1.519 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
HS Code: | 29339990 |
Flash Point: | 228.7°C |
Safety Data |
|
|