Identification |
Name: | 2-Propanone,1-(4-chlorophenyl)- |
Synonyms: | 2-Propanone,(p-chlorophenyl)- (6CI,7CI);2-Propanone, 1-(p-chlorophenyl)- (8CI);p-Chlorophenyl-2-propanone;(p-Chlorophenyl)acetone;1-(4-Chlorophenyl)acetone;1-(4-Chlorophenyl)propan-2-one;1-(p-Chlorophenyl)-2-propanone;4-Chlorobenzylmethyl ketone;Methyl p-chlorobenzyl ketone;NSC 22985;p-Chlorobenzyl methylketone; |
CAS: | 5586-88-9 |
EINECS: | 226-986-4 |
Molecular Formula: | C9H9ClO |
Molecular Weight: | 168.62 |
InChI: | InChI=1/C9H9ClO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3 |
Molecular Structure: |
 |
Properties |
Boiling Point: | 132 ºC (12 mmHg) |
Density: | 1.151 |
Refractive index: | 1.5325-1.5345 |
Appearance: | clear, light yellow liquid |
Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.Store in a cool, dry place. Store in a tightly closed container.
|
Safety Data |
|
 |