| Identification | |
| Name: | 1,2,4-Oxadiazol-5-amine,3-(methylthio)- |
| Synonyms: | NSC344509 |
| CAS: | 55864-39-6 |
| Molecular Formula: | C3H5 N3 O S |
| Molecular Weight: | 131.15 |
| InChI: | InChI=1/C3H5N3OS/c1-8-3-5-2(4)7-6-3/h1H3,(H2,4,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.8°C |
| Boiling Point: | 289.4°Cat760mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.595 |
| Specification: |
5-Amino-3-methylthio-1,2,4-oxadiazole ,with CAS number of 55864-39-6,can be called 3-(methylthio)-1,2,4-oxadiazol-5-amine ; 1,2,4-oxadiazol-5-amine, 3-(methylthio)- . 5-Amino-3-methylthio-1,2,4-oxadiazole (CAS NO.55864-39-6) is a toxic substance,it has the risk of explosion near the melting point of intense decomposition, burning will produce toxic nitrogen oxide and sulfur oxide fumes,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 128.8°C |
| Safety Data | |
 |
|
