| Identification | |
| Name: | Pyridine,3,4-dichloro- |
| Synonyms: | 3,4-Dichloropyridine |
| CAS: | 55934-00-4 |
| Molecular Formula: | C5H3 Cl2 N |
| Molecular Weight: | 147.99 |
| InChI: | InChI=1/C5H3Cl2N/c6-4-1-2-8-3-5(4)7/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 22-23 C |
| Flash Point: | 78.2°C |
| Boiling Point: | 180.1°C at 760 mmHg |
| Density: | 1.388g/cm3 |
| Refractive index: | 1.553 |
| Specification: |
Removal in wastewater treatment of 3,4-Dichloropyridine (55934-00-4) can be stated as follows: |
| Flash Point: | 78.2°C |
| Safety Data | |
 |
|
