| Identification | |
| Name: | 2-Pyrimidinamine,4,6-dichloro- |
| Synonyms: | Pyrimidine,2-amino-4,6-dichloro- (6CI,7CI,8CI);(4,6-Dichloropyrimidin-2-yl)amine;4,6-Dichloro-2-aminopyrimidine;4,6-Dichloro-2-pyrimidinamine;NSC 18698;Py 11;4,6-dichloropyrimidin-2-amine; |
| CAS: | 56-05-3 |
| EINECS: | 200-253-9 |
| Molecular Formula: | C4H3Cl2N3 |
| Molecular Weight: | 163.99272 |
| InChI: | InChI=1S/C4H3Cl2N3/c5-2-1-3(6)9-4(7)8-2/h1H,(H2,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.606 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.633?? |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION Appearance:off-white to tan crystalline powder Transport Information:25kgs Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | off-white to tan crystalline powder |
| Specification: | LIGHT BROWN CRYSTALLINE POWDER Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29335995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols | |
 |
|
