| Identification | |
| Name: | 4-Aminobutyric Acid |
| CAS: | 56-12-2 |
| EINECS: | 200-258-6 |
| Molecular Formula: | C4H9NO2 |
| Molecular Weight: | 103.1198 |
| InChI: | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.8 oC |
| Boiling Point: | 248oC at 760 mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.465 |
| Water Solubility: | SOLUBLE |
| Solubility: | |
| Appearance: | white to off-white solid |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29224995 |
| Biological Activity: | Endogenous inhibitory neurotransmitter. |
| Flash Point: | 103.8 oC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
