| Identification | |
| Name: | chloroamphenicol |
| Synonyms: | chloramphenicol; 2,2-dichloro-n-[2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide; d-(-)-threo-2,2-dichloro-n-[beta-hydroxy-alpha-(hydroxy-methyl)-p-nitrophenethyl]acetamide; chloromycetin |
| CAS: | 56-75-7 |
| EINECS: | 200-287-4 |
| Molecular Formula: | C11H12Cl2N2O5 |
| Molecular Weight: | 323.13 |
| InChI: | InChI=1/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1 |
| Molecular Structure: | ![(C11H12Cl2N2O5) chloramphenicol; 2,2-dichloro-n-[2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide; d-(-)...](https://img.guidechem.com/casimg/56-75-7.gif) |
| Properties | |
| Transport: | UN 1851 |
| Flash Point: | 343.8 oC |
| Boiling Point: | 644.9 oC at 760 mmHg |
| Density: | 1.547 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Alpha: | 19.5 o (C=6, ETOH) |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
? Chloramphenicol (CAS NO.56-75-7), its Synonyms are Acetamide, 2,2-dichloro-N-(2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)-, (R-(R*,R*))- ; Alficetyn ; Ambofen ; Amphenicol ; Amphicol ; Amseclor ; Chlomin ; Chlomycol ; Chlora-tabs ; Chloramex ; Chloramfenikol ; Acetamide, 2,2-dichloro-N-(2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)-, (theta-(theta,theta))- ; Acetamide, 2,2-dichloro-N-(beta-hydroxy-alpha-(hydroxymethyl)-p-nitrophenethyl)-, D-(-)-threo- . It is white to grey-white crystalline powder. |
| Report: |
?Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Flash Point: | 343.8 oC |
| Color: | white |
| Usage: | Broad spectrum antibiotic obtained from cultures of the soil bacterium Streptomyces venezuelae. It has a broad spectrum of activity against Gram-positive and gram-negative bacteria. Antibacterial; antirickettsial |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
