| Identification |
| Name: | 1-Azabicyclo[2.2.2]octan-3-one,2,2-bis(hydroxymethyl)- |
| Synonyms: | 3-Quinuclidinone,2,2-bis(hydroxymethyl)- (7CI,8CI); NSC 281668; PRIMA 1 |
| CAS: | 5608-24-2 |
| Molecular Formula: | C9H15 N O3 |
| Molecular Weight: | 185.22 |
| InChI: | InChI=1/C9H15NO3/c11-5-9(6-12)8(13)7-1-3-10(9)4-2-7/h7,11-12H,1-6H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 167.7°C |
| Boiling Point: | 353.7°Cat760mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.581 |
| Biological Activity: | Selectively restores mutant p53 activity in tumor cells via activation of Bax and PUMA. Induces apoptosis and inhibits growth of human tumors with mutant p53. |
| Flash Point: | 167.7°C |
| Safety Data |
| |
 |
