| Identification | |
| Name: | Benzoic acid, 4-ethyl-,4-cyanophenyl ester |
| Synonyms: | 4-Cyanophenyl4-ethylbenzoate; E 2; E 2 (benzoate); p-Cyanophenyl p-ethylbenzoate |
| CAS: | 56131-48-7 |
| Molecular Formula: | C16H13 N O2 |
| Molecular Weight: | 251.27992 |
| InChI: | InChI=1/C16H13NO2/c1-2-12-3-7-14(8-4-12)16(18)19-15-9-5-13(11-17)6-10-15/h3-10H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.18 g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
4-Cyanophenyl 4-ethylbenzoate , its cas register number is 56131-48-7. It also can be called Benzoic acid, 4-ethyl-,4-cyanophenyl ester . |
| Usage: |
4-Cyanophenyl 4-ethylbenzoate (CAS NO.56131-48-7) can be used as intermediates of liquid crystals. |
| Safety Data | |
 |
|
