| Identification | |
| Name: | Serine, methyl ester,hydrochloride (1:1) |
| Synonyms: | DL-Serine,methyl ester, hydrochloride; Serine, methyl ester, hydrochloride (9CI); Serine,methyl ester, hydrochloride, DL- (8CI); Methyl 2-amino-3-hydroxypropanoatehydrochloride; Methyl 2-amino-3-hydroxypropionate hydrochloride; MethylD,L-serinate hydrochloride |
| CAS: | 5619-04-5 |
| EINECS: | 227-047-1 |
| Molecular Formula: | C4H9 N O3 . Cl H |
| Molecular Weight: | 155.58 |
| InChI: | InChI=1/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 95.8°C |
| Boiling Point: | 234.7°Cat760mmHg |
| Density: | g/cm3 |
| Specification: | white crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29225000 |
| Flash Point: | 95.8°C |
| Storage Temperature: | −20°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
