| Identification | |
| Name: | Triethyllead fluoroacetae |
| Synonyms: | Fluoroacetic acid triethylplumbyl ester |
| CAS: | 562-95-8 |
| Molecular Formula: | C2H2FO2 . C6H15Pb |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C10H14N2O3/c1-2-10(6-4-3-5-7-10)15-9(14)12-8(11)13/h1H,3-7H2,(H3,11,12,13,14) |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Triethyllead fluoroacetae , its cas register number is 562-95-8. It also can be called Acetic acid, fluoro-, triethyllead salt . |
| Report: |
Lead and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
