| Identification | |
| Name: | Nifurpipone hydrochloride |
| Synonyms: | LogP |
| CAS: | 56217-89-1 |
| Molecular Formula: | C12H17N5O4 . ClH |
| Molecular Weight: | 331.7554 |
| InChI: | InChI=1/C12H17N5O4.ClH/c1-15-4-6-16(7-5-15)9-11(18)14-13-8-10-2-3-12(21-10)17(19)20;/h2-3,8H,4-7,9H2,1H3,(H,14,18);1H/b13-8+; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 234.4°C |
| Boiling Point: | 463.9°C at 760 mmHg |
| Density: | 1.41g/cm3 |
| Specification: |
Nifurpipone hydrochloride , its cas register number is 56217-89-1. It also can be called 4-Methyl-1-piperazineacetic acid (5-nitrofurfurylidene)hydrazide hydrochloride ; 1-Piperazineacetic acid, 4-methyl-, (5-nitrofurfurylidene)hydrazide, monohydrochloride ; and Nifurpipone HCl . |
| Flash Point: | 234.4°C |
| Safety Data | |
 |
|
