| Identification | |
| Name: | Ethanamine,N-ethoxy-N-nitroso- |
| Synonyms: | N-Nitroso-O,N-diethylhydroxylamine |
| CAS: | 56235-95-1 |
| Molecular Formula: | C4H10 N2 O2 |
| Molecular Weight: | 118.16 |
| InChI: | InChI=1/C4H10N2O2/c1-3-6(5-7)8-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 17.3°C |
| Boiling Point: | 105.1°C at 760 mmHg |
| Density: | 1.03g/cm3 |
| Refractive index: | 1.436 |
| Specification: |
Nitrosoethoxyethylamine , its cas register number is 56235-95-1. It also can be called Hydroxylamine, O,N-diethyl-N-nitroso- ; N-Nitroso-O,N-diaethylhydroxylamin ; and O,N-Diethyl-N-nitrosohydroxylamine . |
| Flash Point: | 17.3°C |
| Safety Data | |
 |
|
