| Identification | |
| Name: | Cyclohexanol, 4-amino-,hydrochloride (1:1), cis- |
| Synonyms: | Cyclohexanol,4-amino-, hydrochloride, cis- (9CI); cis-4-Aminocyclohexanol hydrochloride;cis-4-Hydroxycyclohexylamine hydrochloride |
| CAS: | 56239-26-0 |
| Molecular Formula: | C6H13 N O . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C6H13NO.ClH/c7-5-1-3-6(8)4-2-5;/h5-6,8H,1-4,7H2;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.037g/cm3 |
| Specification: | usageEng:cis-4-Aminocyclohexanol used in the preparation of potential hypertensive agents and other biologically active compounds. |
| Usage: | cis-4-Aminocyclohexanol used in the preparation of potential hypertensive agents and other biologically active compounds. |
| Safety Data | |
 |
|
