| Identification | |
| Name: | 4-Piperidinecarbonitrile, 4-phenyl-1-(phenylmethyl)- |
| Synonyms: | 1-Benzyl-4-cyano-4-phenylpiperidine;1-Benzyl-4-phenyl-4-piperidinecarbonitrile |
| CAS: | 56243-25-5 |
| Molecular Formula: | C19H20N2 |
| Molecular Weight: | 312.84 |
| InChI: | InChI=1S/C19H20N2/c20-16-19(18-9-5-2-6-10-18)11-13-21(14-12-19)15-17-7-3-1-4-8-17/h1-10H,11-15H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 250-259 ºC |
| Flash Point: | 184.3°C |
| Boiling Point: | 430.4°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Specification: |
1-Benzyl-4-phenylpiperidine-4-carbonitrile hydrochloride (1:1) , with CAS number of 56243-25-5, can be called 4-piperidinecarbonitrile, 4-phenyl-1-(phenylmethyl)-, hydrochloride (1:1) ; 1-Benzyl-4-cyano-4-phenylpiperidine HCl ; 1-Benzyl-4-cyano-4-phenylpiperidine Hydrochloride ; 1-Benzyl-4-cyano-4-phenylpiperidine hydrochloride 99% ; 1-Benzyl-4-phenylpiperidine-4-carbonitrile hydrochloride ; 1-benzyl-4-phenylpiperidine-4-carbonitrile monohydrochloride . It is an off-white crystalline solid, used as a piperidine derivative as calcium channel blocker. |
| Flash Point: | 184.3°C |
| Usage: | A piperidine derivative as calcium channel blockers |
| Safety Data | |
 |
|
