| Identification | |
| Name: | Parsol Hydro |
| Synonyms: | DEA-Methoxycinnamate;AC1O5T5R;Diethanolamine methoxycinnamate;EINECS 260-082-0;2-Propenoic acid, 3-(4-methoxyphenyl)-, compd. with 2,2'-iminobis(ethanol) (1:1);p-Methoxycinnamic acid, compound with 2,2'-iminodiethanol (1:1);2-(2-hydroxyethylamino)ethanol; (E)-3-(4-methoxyphenyl)prop-2-enoic acid;3-(4-Methoxyphenyl)-2-propenoic acid compd. with 2,2'-iminobis(ethanol);2-Propenoic acid, 3-(4-methoxyphenyl)-, compd. with 2,2'-iminobis(ethanol);56265-46-4;73560-31-3 |
| CAS: | 56265-46-4 |
| EINECS: | 260-082-0 |
| Molecular Formula: | C14H21NO5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H10O3.C4H11NO2/c1-13-9-5-2-8(3-6-9)4-7-10(11)12;6-3-1-5-2-4-7/h2-7H,1H3,(H,11,12);5-7H,1-4H2/b7-4+; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 138.5°C |
| Boiling Point: | 342.6°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 138.5°C |
| Safety Data | |
 |
|
