| Identification | |
| Name: | 2-Methylbutene-1 (99% min.) |
| Synonyms: | 2-Methylbutene-1 (99%; Methylbutenemin; 2-METHYLBUTENE-1; 2-Methyl-1-butene |
| CAS: | 563-46-2 |
| EINECS: | 209-250-7 |
| Molecular Formula: | C5H10 |
| Molecular Weight: | 70.1329 |
| InChI: | InChI=1S/C5H10/c1-4-5(2)3/h2,4H2,1,3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2459 3/PG 1 |
| Melting Point: | −137 °C(lit.) |
| Flash Point: | -48 C (closed cup) |
| Density: | 0.65 g/mL at 25 °C(lit.) |
| Stability: | Stable. Incompatible with oxidizing agents. Extremely flammable. |
| Refractive index: | n20/D 1.378(lit.) |
| Solubility: | Sol in alcohol, ether, benzene In water, 130 mg/l @ 20 deg C. |
| Appearance: | colourless liquid |
| Specification: |
If inhalation or contact with material may irritate or burn skin and eyes. Fire may produce irritating, corrosive and/or toxic gases. Vapors may cause dizziness or suffocation. Runoff from fire control or dilution water may cause pollution. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Flash Point: | -48 C (closed cup) |
| Storage Temperature: | 2-8°C |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
