| Identification |
| Name: | 3-Chloro-1-butene |
| Synonyms: | -3-Chloro-1-butene; alpha-Methallyl chloride; 1-Methylallyl chloride |
| CAS: | 563-52-0 |
| EINECS: | 209-252-8 |
| Molecular Formula: | C4H7Cl |
| Molecular Weight: | 90.55 |
| InChI: | InChI=1/C4H7Cl/c1-3-4(2)5/h3-4H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 3 |
| Density: | 0.9 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4145-1.4165 |
| Water Solubility: | immiscible |
| Solubility: | Immiscible with water |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | II |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
