| Identification | |
| Name: | Propanoyl bromide,2-bromo- |
| Synonyms: | Propionylbromide, 2-bromo- (6CI,7CI);2-Bromopropanoyl bromide;DL-2-Bromopropionyl bromide;a-Bromopropanyl bromide;a-Bromopropionyl bromide; |
| CAS: | 563-76-8 |
| EINECS: | 209-261-7 |
| Molecular Formula: | C3H4Br2O |
| Molecular Weight: | 215.87 |
| InChI: | InChI=1/C3H4Br2O/c1-2(4)3(5)6/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 2.061 |
| Refractive index: | 1.518 |
| Appearance: | Pale yellow transparent liquid |
| Specification: |
2-Bromopropionyl bromide (CAS NO.563-76-8) decomposes with water and alcohol. |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
