| Identification | |
| Name: | 2,3-Dimethyl-2-butene |
| Synonyms: | 2,3-Dimethylbutene-2; Tetramethylethylene; 2,3-Dimethylbut-2-ene; BISOMER DMB 2 |
| CAS: | 563-79-1 |
| EINECS: | 209-263-8 |
| Molecular Formula: | C6H12 |
| Molecular Weight: | 84.16 |
| InChI: | InChI=1/C6H12/c1-5(2)6(3)4/h1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 |
| Density: | 0.708 |
| Stability: | Stable. Highly flammable - readily forms explosive mixtures with air. Note low flash point. Incompatible with strong acids, strong oxidizing agents, peroxy compounds. |
| Refractive index: | 1.411-1.413 |
| Solubility: | insoluble
|
| Appearance: | colourless liquid |
| Packinggroup: | II |
| HS Code: | 29012980 |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
