| Identification |
| Name: | Benzene,1-isocyanato-2-(1-methylethyl)- |
| Synonyms: | 1-Isocyanato-2-isopropylbenzene;2-Isopropylphenyl isocyanate;o-Cumenyl isocyanate; |
| CAS: | 56309-56-9 |
| EINECS: | 260-105-4 |
| Molecular Formula: | C10H11NO |
| Molecular Weight: | 161.2 |
| InChI: | InChI=1/C10H11NO/c1-8(2)9-5-3-4-6-10(9)11-7-12/h3-6,8H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2206 |
| Flash Point: | 190? |
| Density: | 1.019 |
| Stability: | No data. |
| Refractive index: | 1.524 |
| Solubility: | Insoluble |
| Packinggroup: | III |
| Flash Point: | 190? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
