| Identification | |
| Name: | L-Histidine, N-acetyl-b-alanyl- |
| Synonyms: | Histidine,N-(N-acetyl-b-alanyl)-,L- (6CI); L-Histidine, N-(N-acetyl-b-alanyl)-; Can-C; N-(N-Acetyl-b-alanyl)histidine; N-Acetyl-L-carnosine; N-Acetylcarnosine |
| CAS: | 56353-15-2 |
| EINECS: | 260-123-2 |
| Molecular Formula: | C11H16 N4 O4 |
| Molecular Weight: | 268.27 |
| InChI: | InChI=1/C11H16N4O4/c1-7(16)13-3-2-10(17)15-9(11(18)19)4-8-5-12-6-14-8/h5-6,9H,2-4H2,1H3,(H,12,14)(H,13,16)(H,15,17)(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 253 - 260 C |
| Density: | 1.343 g/cm3 |
| Refractive index: | 1.563 |
| Solubility: | |
| Appearance: | white to off-white powder |
| Specification: | White Crystalline Solid usageEng:Used in the treatment of cataracts and in the treatment of UV-induced immunosuppression |
| Usage: | 1. N-Acetyl-l-carnosine (CAS NO.56353-15-2) is used in the treatment of cataracts and in the treatment of UV-induced immunosuppression. |
| Safety Data | |
| Hazard Symbols | |
 |
|
