| Identification | |
| Name: | Bicyclo[3.1.1]hept-2-ene-2-carboxaldehyde,6,6-dimethyl- |
| CAS: | 564-94-3 |
| EINECS: | 209-274-8 |
| Molecular Formula: | C10H14 O |
| Molecular Weight: | 150.24 |
| InChI: | InChI=1/C10H14O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,6,8-9H,4-5H2,1-2H3/t8-,9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 78.9°C |
| Boiling Point: | 215.7°Cat760mmHg |
| Density: | 1.061g/cm3 |
| Refractive index: | n20/D 1.504 |
| Specification: |
Myrtenal with CAS Registry Number of 564-94-3 is clear colourless to yellow liquid, also known as 2-Formyl-6,6-dimethylbicyclo(3.1.1)hept-2-ene ; 2-Norpinene-2-carboxaldehyde, 6,6-dimethyl- ; 6,6-Dimethyl-2-norpinene-2-carboxaldehyde ; 6,6-Dimethylbicyclo(3.1.1)hept-2-ene-2-carboxaldehyde ; Benihinal ; Bicyclo(3.1.1)hept-2-ene-2-carboxaldehyde, 6,6-dimethyl- ; FEMA No. 3395 ; NSC 54384 ; 2-Norpinene-2-carboxaldehyde, 6,6-dimethyl- (8CI) ; Pin-2-ene-1-carbaldehyde . Myrtenal is a kind of spice and can be used for synthesis of more valuable spices such as basil Draba . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 78.9°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
