| Identification |
| Name: | [(4-nitrophenyl)methyl]succinic acid |
| Synonyms: | [(4-nitrophenyl)methyl]succinic acid;2-(4-Nitrobenzyl)butanedioic acid;Einecs 260-164-6 |
| CAS: | 56416-12-7 |
| EINECS: | 260-164-6 |
| Molecular Formula: | C11H11NO6 |
| Molecular Weight: | 253.20814 |
| InChI: | InChI=1/C11H11NO6/c13-10(14)6-8(11(15)16)5-7-1-3-9(4-2-7)12(17)18/h1-4,8H,5-6H2,(H,13,14)(H,15,16) |
| Molecular Structure: |
![(C11H11NO6) [(4-nitrophenyl)methyl]succinic acid;2-(4-Nitrobenzyl)butanedioic acid;Einecs 260-164-6](https://img.guidechem.com/structure/56416-12-7.gif) |
| Properties |
| Flash Point: | 182.9°C |
| Boiling Point: | 426.9°C at 760 mmHg |
| Density: | 1.461g/cm3 |
| Stability: | Store in Freezer |
| Refractive index: | 1.6 |
| Flash Point: | 182.9°C |
| Usage: | An intermediate in the synthesis of D,L-(p-aminobenzyl)succinic acid which has been used as a ligand for affinity chromatographic isolation of pancreatic carboxypeptidase A and B enzymes.
See also: Cat. No. B2920 |
| Safety Data |
| |
 |
