| Identification | |
| CAS: | 56436-30-7 |
| Molecular Formula: | C14H18N2O6S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H16N2O2.H2O4S/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;1-5(2,3)4/h3-8H,15-16H2,1-2H3;(H2,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 137 deg C |
| Flash Point: | 202.8°C |
| Boiling Point: | 391.3°C at 760 mmHg |
| Density: | 1.178g/cm3 |
| Solubility: | Sol in alc, benzene, ether Sol in chloroform, acetone PROBABLY SOL IN MOST ORG SOLVENTS AND LIPIDS In water, 60 mg/l @ 25 deg C |
| Flash Point: | 202.8°C |
| Color: | LEAFLETS OR NEEDLES FROM WATER Colorless crystals that turn a violet color on standing. |
| Safety Data | |
 |
|
