| Identification |
| Name: | Benzenemethanol,2,4-difluoro- |
| Synonyms: | (2,4-Difluorophenyl)methanol;2,4-Difluorobenzyl alcohol |
| CAS: | 56456-47-4 |
| EINECS: | 260-191-3 |
| Molecular Formula: | C7H6 F2 O |
| Molecular Weight: | 144.12 |
| InChI: | InChI=1/C7H6F2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 194.3°Cat760mmHg |
| Density: | 1.29 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.487 |
| Appearance: | Colorless liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
