| Identification | |
| Name: | Propanoic acid,3-amino-2-hydroxy- |
| CAS: | 565-71-9 |
| Molecular Formula: | C3H7 N O3 |
| Molecular Weight: | 105.09 |
| InChI: | InChI=1/C3H7NO3/c4-1-2(5)3(6)7/h2,5H,1,4H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 235 ºC (dec.) |
| Flash Point: | 187.6°C |
| Boiling Point: | 386.6°Cat760mmHg |
| Density: | 1.415g/cm3 |
| Refractive index: | 1.519 |
| Specification: | White powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 187.6°C |
| Safety Data | |
 |
|
