| Identification | |
| Name: | Pyrrolidine, 2-phenyl-,(2R)- |
| Synonyms: | Pyrrolidine,2-phenyl-, (R)-;(2R)-2-Phenylpyrrolidine;(R)-(+)-2-Phenylpyrrolidine;(R)-2-Phenylpyrrolidine; |
| CAS: | 56523-47-8 |
| Molecular Formula: | C10H13N |
| Molecular Weight: | 147.22 |
| InChI: | InChI=1/C10H13N/c1-2-5-9(6-3-1)10-7-4-8-11-10/h1-3,5-6,10-11H,4,7-8H2/t10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.988 g/cm3 |
| Refractive index: | 1.533 |
| Specification: |
The (R)-2-Phenylpyrrolidine, with the cas registry number 56523-47-8, has the systematic name of (2R)-2-phenylpyrrolidine. It belongs to the following product categories: pharmaceutical intermediate;Chiral heterocyclic compounds. And the molecular formula of the chemical is C10H13N. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.78; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.31; (4)ACD/LogD (pH 7.4): -1.01; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 3.24 Å2; (13)Index of Refraction: 1.533; (14)Molar Refractivity: 46.23 cm3; (15)Molar Volume: 148.9 cm3; (16)Polarizability: 18.33×10-24cm3; (17)Surface Tension: 36.6 dyne/cm; (18)Density: 0.988 g/cm3; (19)Flash Point: 98.3 °C; (20)Enthalpy of Vaporization: 47.38 kJ/mol; (21)Boiling Point: 237 °C at 760 mmHg; (22)Vapour Pressure: 0.0459 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
