| Identification | |
| Name: | URB602 |
| Synonyms: | URB602;Biphenyl-3-yl Carbamic Acid, Cyclohexyl Ester |
| CAS: | 565460-15-3 |
| Molecular Formula: | C19H21NO2 |
| Molecular Weight: | 295.38 |
| InChI: | InChI=1/C19H21NO2/c21-19(22-18-12-5-2-6-13-18)20-17-11-7-10-16(14-17)15-8-3-1-4-9-15/h1,3-4,7-11,14,18H,2,5-6,12-13H2,(H,20,21) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205.759°C |
| Boiling Point: | 416.611°C at 760 mmHg |
| Density: | 1.149g/cm3 |
| Refractive index: | 1.595 |
| Appearance: | off-white solid |
| Flash Point: | 205.759°C |
| Usage: | URB602 is a selective inhibitor of MGL, exhibiting an IC50 of 28 for the rat brain enzyme. It does not inhibit fatty acid amide hydrolase (FAAH) at concentrations up to 100 , or other lipid metabolizing enzymes such as diacylglycerol lipase or |
| Safety Data | |
 |
|
