| Identification | |
| Name: | D-arabino-Hexose,3,6-dideoxy- |
| Synonyms: | D-Mannose,3,6-dideoxy- (6CI); 3,6-Dideoxy-D-arabino-hexose; 3,6-Dideoxy-D-mannose;D-Tyvelose; Tyvelose |
| CAS: | 5658-12-8 |
| Molecular Formula: | C6H12 O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5+,6+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | NA |
| Flash Point: | 188.8°C |
| Boiling Point: | 365°Cat760mmHg |
| Density: | 1.249g/cm3 |
| Specification: | Off-White Waxy Solid (low-melting) usageEng:The unusual sugar Tyvelose is the immunodominant portion of the major larval glycoprotein antigens of Trichinella spiralis, which play an important role in generating immunity against the intestinal stages of infection. |
| Flash Point: | 188.8°C |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Usage: | The unusual sugar Tyvelose is the immunodominant portion of the major larval glycoprotein antigens of Trichinella spiralis, which play an important role in generating immunity against the intestinal stages of infection. |
| Safety Data | |
 |
|
