Identification |
Name: | 4-methylbenzenesulfonic acid; 1-oxido-2-pyridin-2-yl-indol-3-one |
Synonyms: | 2-(2-PYRIDINYL)-(3H)-INDOL-3-ONE-1-OXIDE 4-METHYLBENZENESULFONATE;PIT;2,2'-pyridylisatogen tosylate |
CAS: | 56583-49-4 |
Molecular Formula: | C13H8N2O2 |
Molecular Weight: | 396.42 |
InChI: | InChI=1S/C13H8N2O2/c16-13-9-5-1-2-7-11(9)15(17)12(13)10-6-3-4-8-14-10/h1-8H |
Molecular Structure: |
|
Properties |
Biological Activity: | Purinergic P2Y receptor ligand. Displays irreversible antagonism at P2Y receptors in some smooth muscles but potentiates responses to ATP in other systems (chick brain recombinant P2Y 1 receptor and sympathetic/purinergic nerve stimulation). |
Safety Data |
|
|