| Identification | |
| Name: | 5-Bromo-3-methyl-2-(morpholino)pyridine |
| Synonyms: | 4-(5-bromo-3-methyl-2-pyridyl)morpholine;morpholine, 4-(5-bromo-3-methyl-2-pyridinyl)-;4-(5-bromo-3-methyl-2-pyridinyl)morpholine; |
| CAS: | 566158-47-2 |
| Molecular Formula: | C10H13BrN2O |
| Molecular Weight: | 257.13 |
| InChI: | InChI=1/C10H13BrN2O/c1-8-6-9(11)7-12-10(8)13-2-4-14-5-3-13/h6-7H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.441 |
| Refractive index: | 1.571 |
| Specification: |
The 5-Bromo-3-methyl-2-(morpholino)pyridine with the cas number 566158-47-2, is also called 4-(5-bromo-3-methyl-2-pyridyl)morpholine .This product can be supplied by the following suppliers: (1)BePharm,Ltd. ; (2)Capot Chemical Co., Ltd.; (3)Shanghai Apichemical CO.,LTD.; (4)Ark Pharm, Inc.. The properties of the chemical are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 25.36 Å2 ; (5)Index of Refraction: 1.571 ; (6)Molar Refractivity: 58.66 cm3 ; (7)Molar Volume: 178.4 cm3 ; (8)Polarizability: 23.25×10-24cm3 ; (9)Surface Tension: 46.5 dyne/cm ; (10)Enthalpy of Vaporization: 61.47 kJ/mol ; (11)Vapour Pressure: 1.3×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
