| Identification | |
| Name: | 8-Oxaspiro[4.5]decane-7,9-dione |
| Synonyms: | 1,1-Cyclopentanediaceticanhydride (7CI,8CI); 1,1-Cyclopentanediacetic acid anhydride;3,3-Tetramethyleneglutaric anhydride; NSC 78448 |
| CAS: | 5662-95-3 |
| EINECS: | 227-116-6 |
| Molecular Formula: | C9H12 O3 |
| Molecular Weight: | 168.19 |
| InChI: | InChI=1/C9H12O3/c10-7-5-9(3-1-2-4-9)6-8(11)12-7/h1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 64-66 ºC |
| Density: | 1.19 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.502 |
| Water Solubility: | decomposes |
| Solubility: | Decomposes in water |
| Appearance: | white glistening crystals |
| Specification: |
3,3-Tetramethyleneglutaric anhydride , its cas register number is 5662-95-3. It also can be called Cyclopentane-1,1-diacetic anhydride ; 8-Oxaspiro[4.5]decane-7,9-dione .It is a white glistening crystals. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
