| Identification | |
| Name: | 3-Benzofurancarboxylicacid, 4,5,6,7-tetrahydro-4-oxo- |
| Synonyms: | 4,5,6,7-Tetrahydro-4-oxo-3-benzofurancarboxylicacid;4-Oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid;4-Oxo-4,5,6,7-tetrahydrobenzofuran-3-carboxylic acid;4-Oxo-4,5,6,7-tetrahydrocoumarone-3-carboxylic acid; |
| CAS: | 56671-28-4 |
| Molecular Formula: | C9H8O4 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C9H8O4/c10-6-2-1-3-7-8(6)5(4-13-7)9(11)12/h4H,1-3H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 140 °C |
| Flash Point: | 185.7°C |
| Boiling Point: | 383.5°Cat760mmHg |
| Density: | 1.406g/cm3 |
| Refractive index: | 1.576 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 185.7°C |
| Safety Data | |
 |
|
