| Identification | |
| Name: | Phenol,4-(2-methoxyethyl)- |
| Synonyms: | Phenol,p-(2-methoxyethyl)- (6CI,7CI);4-(2-Methoxyethyl)phenol;p-Hydroxyphenethyl methyl ether;4-(2-methoxyethyl)-phenol; |
| CAS: | 56718-71-9 |
| EINECS: | 260-354-9 |
| Molecular Formula: | C9H12O2 |
| Molecular Weight: | 152.19038 |
| InChI: | InChI=1S/C9H12O2/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5,10H,6-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | STABILITY |
| Density: | 1.06 g/cm3 |
| Refractive index: | 1.525 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble Appearance:White to light yellow melt Transport Information: OTH Hazard Symbols:UN NO. |
| Appearance: | White to light yellow melt |
| Specification: | White Low Melting Solid usageEng:Impurity of Metoprolol Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | STABILITY |
| Storage Temperature: | Refrigerator |
| Usage: | Impurity of Metoprolol |
| Safety Data | |
| Hazard Symbols | |
 |
|
