Identification |
Name: | Phenol,4-(2-methoxyethyl)- |
Synonyms: | Phenol,p-(2-methoxyethyl)- (6CI,7CI);4-(2-Methoxyethyl)phenol;p-Hydroxyphenethyl methyl ether;4-(2-methoxyethyl)-phenol; |
CAS: | 56718-71-9 |
EINECS: | 260-354-9 |
Molecular Formula: | C9H12O2 |
Molecular Weight: | 152.19038 |
InChI: | InChI=1S/C9H12O2/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5,10H,6-7H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | OTH |
Flash Point: | STABILITY |
Density: | 1.06 g/cm3 |
Refractive index: | 1.525 |
Water Solubility: | slightly soluble |
Solubility: | slightly soluble Appearance:White to light yellow melt Transport Information: OTH Hazard Symbols:UN NO. |
Appearance: | White to light yellow melt |
Specification: | White Low Melting Solid usageEng:Impurity of Metoprolol Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | STABILITY |
Storage Temperature: | Refrigerator |
Usage: | Impurity of Metoprolol |
Safety Data |
Hazard Symbols |
|
|
 |