| Identification | |
| Name: | 2-Amino-5-bromo-6-phenylpyrimidin-4-ol |
| Synonyms: | Bropirimine;2-Amino-5-bromo-6-phenyl-1H-pyrimidin-4-one;4-Pyrimidinol, 2-amino-5-bromo-6-phenyl-;4 (1H)-Pyrimidinone, 2-amino-5-bromo-6-phenyl-;2-Amino-5-bromo-6-phenyl-4(1H)-pyrimidinone;ABPP;4(1H)-Pyrimidinone, 5-bromo-2, 3-dihydro-2-imino-6-phenyl-;4(1H)-Pyrimidinone,2-amino-5-bromo-6- phenyl-;U-54461; |
| CAS: | 56741-95-8 |
| Molecular Formula: | C10H8BrN3O |
| Molecular Weight: | 266.12 |
| InChI: | InChI=1/C10H8BrN3O/c11-7-8(6-4-2-1-3-5-6)13-10(12)14-9(7)15/h1-5H,(H3,12,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 189.5°C |
| Boiling Point: | 389.7°Cat760mmHg |
| Density: | 1.74g/cm3 |
| Refractive index: | 1.715 |
| Specification: |
2-Amino-5-bromo-6-phenylpyrimidin-4-ol (CAS.56741-95-8) also can be called 2-Amino-5-bromo-6-phenylpyrimidin-4(1H)-one ; 4(1H)-pyrimidinone, 2-amino-5-bromo-6-phenyl- and; 2-Amino-5-bromo-6-phenyl-4(1H)-pyrimidinone . |
| Flash Point: | 189.5°C |
| Usage: | Bropirimine is an orally active immunostimulant; anticancer agent. Bropirimine is an interferon inducer that is a potentially useful in the the treatment of superficial bladder cancer (transitional cell carcinoma). Studies suggest that Bropirimine has direct antitumor activity rather than a cytokine-mediated antitumor effect. |
| Safety Data | |
 |
|
