| Identification |
| Name: | Benzoxazole,2,5-dimethyl- |
| Synonyms: | 2,5-Dimethylbenzoxazole;NSC 93785; |
| CAS: | 5676-58-4 |
| EINECS: | 227-136-5 |
| Molecular Formula: | C9H9NO |
| Molecular Weight: | 147.17386 |
| InChI: | InChI=1S/C9H9NO/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.09 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5425-1.5445 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | brown clear liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
