| Identification | |
| Name: | 2-Propen-1-amine,3-(4-bromophenyl)-N,N-dimethyl-3-(3-pyridinyl)-, (2Z)- |
| Synonyms: | 2-Propen-1-amine,3-(4-bromophenyl)-N,N-dimethyl-3-(3-pyridinyl)-, (Z)-; (Z)-Zimelidine; H102/09; Zimeldine; Zimelidine; cis-H 102/09; cis-Zimelidine |
| CAS: | 56775-88-3 |
| EINECS: | 262-279-7 |
| Molecular Formula: | C16H17 Br N2 |
| Molecular Weight: | 317.26 |
| InChI: | InChI=1/C16H17BrN2.2ClH/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13;;/h3-10,12H,11H2,1-2H3;2*1H/b16-9-;; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 203.4°C |
| Boiling Point: | 412.8°Cat760mmHg |
| Density: | 1.286g/cm3 |
| Solubility: | In water, 190 mg/L at 25 deg C (est) |
| Specification: |
Zimeldine ,its cas register number is 56775-88-3.It also can be called (Z)-3-(4'-Bromophenyl)-3-(3''-pyridyl)dimethylallylamine ; (Z)-Zimelidine ; 3-(4-Bromophenyl)-N,N-dimethyl-3-(3-pyridinyl)-2-propen-1-amine . |
| Biological Activity: | 5-HT re-uptake inhibitor; selective over noradrenalin and dopamine uptake (IC 50 values are 0.33, 8.2 and 12 μ M respectively). Modulates nociception and induces hyperglycemia in vivo , and is an orally active antidepressant. |
| Flash Point: | 203.4°C |
| Storage Temperature: | Desiccate at RT |
| Color: | white |
| Usage: |
Zimeldine (CAS NO.56775-88-3) is used as a serotonin uptake inhibitor and antidepressant |
| Safety Data | |
 |
|
