| Identification | |
| Name: | 6,12-Dimethylbenz(a)anthracene |
| Synonyms: | 6,12-Dimethylbenz[a]anthracene |
| CAS: | 568-81-0 |
| Molecular Formula: | C20H16 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H16/c1-13-11-15-7-4-6-10-18(15)20-14(2)17-9-5-3-8-16(17)12-19(13)20/h3-12H,1-2H3 |
| Molecular Structure: | ![(C20H16) 6,12-Dimethylbenz[a]anthracene](https://img.guidechem.com/crawlimg/568-81-0.png) |
| Properties | |
| Flash Point: | 227.3°C |
| Boiling Point: | 463.5°C at 760 mmHg |
| Density: | 1.142g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
6,12-Dimethylbenz(a)anthracene , its cas register number is 568-81-0. It also can be called 3-05-00-02412 (Beilstein Handbook Reference) ; 4,9-Dimethyl-1,2-benzanthracene ; BRN 1962611 . When 6,12-Dimethylbenz(a)anthracene (CAS NO.568-81-0) is heated to decomposition, it emits acrid smoke and irritating fumes. |
| Flash Point: | 227.3°C |
| Safety Data | |
 |
|
