| Identification |
| Name: | Propanamide,3-amino-N-[2-(1H-imidazol-5-yl)ethyl]- |
| Synonyms: | Propanamide,3-amino-N-[2-(1H-imidazol-4-yl)ethyl]- (9CI); Alistin; Carcinine; b-Alanylhistamine |
| CAS: | 56897-53-1 |
| Molecular Formula: | C8H14 N4 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H14N4O.2ClH/c9-3-1-8(13)11-4-2-7-5-10-6-12-7;;/h5-6H,1-4,9H2,(H,10,12)(H,11,13);2*1H |
| Molecular Structure: |
![(C8H14N4O) Propanamide,3-amino-N-[2-(1H-imidazol-4-yl)ethyl]- (9CI); Alistin; Carcinine; b-Alanylhistamine](https://img1.guidechem.com/chem/e/dict/183/56897-53-1.jpg) |
| Properties |
| Flash Point: | 285°C |
| Boiling Point: | 547.6°Cat760mmHg |
| Density: | 1.191g/cm3 |
| Biological Activity: | Highly selective H 3 receptor antagonist (K i values are 0.30, 365 and 3621 μ M for H 3 , H 2 and H 1 receptors respectively). Acts as a natural antioxidant with hydroxyl radical scavenging and lipid peroxidase activities. |
| Flash Point: | 285°C |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
