| Identification | |
| Name: | 5H-Benzocyclohepten-5-one,2,3,4,6-tetrahydroxy- |
| Synonyms: | Purpurogallin(6CI); 2,3,4,6-Tetrahydroxy-5H-benzo[a]cyclohepten-5-one; NSC 35676; NSC 646653 |
| CAS: | 569-77-7 |
| EINECS: | 209-324-9 |
| Molecular Formula: | C11H8 O5 |
| Molecular Weight: | 220.19 |
| InChI: | InChI=1/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14) |
| Molecular Structure: | ![(C11H8O5) Purpurogallin(6CI); 2,3,4,6-Tetrahydroxy-5H-benzo[a]cyclohepten-5-one; NSC 35676; NSC 646653](https://img1.guidechem.com/chem/e/dict/14/569-77-7.jpg) |
| Properties | |
| Melting Point: | 275 °C (dec.)(lit.) |
| Flash Point: | 184.5°C |
| Boiling Point: | 357.9°Cat760mmHg |
| Density: | 1.74g/cm3 |
| Refractive index: | 1.79 |
| Specification: | BROWN FINE CRYSTALLINE POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 184.5°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
