| Identification | |
| Name: | Benzene,1-(4-bromophenoxy)-2-nitro- |
| Synonyms: | Ether,p-bromophenyl o-nitrophenyl (6CI); 2-(4-Bromophenoxy)-1-nitrobenzene; NSC 78380 |
| CAS: | 56966-62-2 |
| Molecular Formula: | C12H8 Br N O3 |
| Molecular Weight: | 294.1 |
| InChI: | InChI=1/C12H8BrNO3/c13-9-5-7-10(8-6-9)17-12-4-2-1-3-11(12)14(15)16/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.6°C |
| Boiling Point: | 360.1°C at 760 mmHg |
| Density: | 1.563g/cm3 |
| Refractive index: | 1.63 |
| Specification: |
The 1-(4-Bromophenoxy)-2-nitrobenzene, with the cas registry number 56966-62-2, is also called Nsc78380. And the molecular formula of the chemical is C12H8BrNO3. The characteristics of this chemical are as followings: (1)ACD/LogP: 4.51; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 55.05 Å2; (7)Index of Refraction: 1.63; (8)Molar Refractivity: 66.93 cm3; (9)Molar Volume: 188 cm3; (10)Polarizability: 26.53×10-24cm3; (11)Surface Tension: 51.7 dyne/cm; (12)Density: 1.563 g/cm3; (13)Flash Point: 171.6 °C; (14)Enthalpy of Vaporization: 58.19 kJ/mol; (15)Boiling Point: 360.1 °C at 760 mmHg; (16)Vapour Pressure: 4.72E-05 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 171.6°C |
| Safety Data | |
 |
|
