| Identification | |
| Name: | Acetamide,N-(aminoiminomethyl)- |
| Synonyms: | Acetamide,N-amidino- (7CI,8CI);1-Acetylguanidine;Acetoguanidine;Acetylguanidine;Guanidine, acetyl-;N-Acetylguanidine; |
| CAS: | 5699-40-1 |
| EINECS: | 227-180-5 |
| Molecular Formula: | C3H7N3O |
| Molecular Weight: | 101.11 |
| InChI: | InChI=1/C3H7N3O/c1-2(7)6-3(4)5/h1H3,(H4,4,5,6,7)/p+1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 181-183 °C(lit.) |
| Flash Point: | 98.2°C |
| Boiling Point: | 238.7°Cat760mmHg |
| Density: | 1.34g/cm3 |
| Appearance: | White to off-white powder |
| Specification: |
The 1-Acetylguanidine with the cas number 5699-40-1 is also called Acetamide,N-(aminoiminomethyl)-. The systematic name is N-(Aminoiminomethyl)acetamide. Its EINECS registry number is 227-180-5. The molecular formula is C3H7N3O. This chemical belongs to the following product categories: (1)Guanidines; (2)Nitrogen Compounds; (3)Organic Building Blocks. Uses: This chemical can react with 5-(5-bromo-4-oxo-pentyl)-4,5-dihydro-isoxazole-3-carboxylic acid ethyl ester to prepare 5-[3-(2-acetylamino-3H-imidazol-4-yl)-propyl]-4,5-dihydro-isoxazole-3-carboxylic acid ethyl ester. This reaction needs solvent dimethylformamide at temperature of 20 °C. The reaction time is 4.0 days. The yield is 35%. This reaction is condensation. You can still convert the following datas into molecular structure: |
| Flash Point: | 98.2°C |
| Safety Data | |
 |
|
