Identification |
Name: | D(-)-Fructose |
Synonyms: | Fructose, D-(8CI);Advantose FS 95;D-(-)-Fructose;D-(-)-Levulose;D-arabino-2-Hexulose;Fructose;Fruit sugar;Fujifructo L 95;Furucton;Hi-Fructo 970;Krystar;Krystar 300;Levulose;Nevulose;Sugar, fruit; |
CAS: | 57-48-7 |
EINECS: | 200-333-3 |
Molecular Formula: | C6H12O6 |
Molecular Weight: | 180.16 |
InChI: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1 |
Molecular Structure: |
 |
Properties |
Transport: | LS7120000 |
Melting Point: | 119-122 oC (dec.) |
Density: | 1.589 g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Alpha: | -92.25 o (C=10,H2O,ON DRY SUB.) |
Water Solubility: | 3750 G/L (20 oC) |
Solubility: | 3750 g/L (20 oC) IN WATER |
Appearance: | White Cyrstalline Solid |
HS Code: | 17025000 |
Usage: | To prevent sandiness in ice cream. |
Safety Data |
|
 |