| Identification | |
| Name: | Estra-1,3,5(10)-triene-3,17-diol,(17a)- |
| Synonyms: | 17a-Estradiol (8CI);1,3,5-Estratriene-3,17a-diol;13b-Methyl-1,3,5(10)-gonatriene-3,17a-diol;17-Epiestradiol;17a-Oestradiol;3,17-Dihydroxyestratriene;3,17a-Dihydroxyestra-1,3,5(10)-triene;3,17a-Dihydroxyoestra-1,3,5(10)-triene;Alfatradiol;Epiestrol;Estra-1,3,5(10)-triene-3,17a-diol;NSC 20293;Oestra-1,3,5(10)-triene-3,17a-diol;a-Estradiol; |
| CAS: | 57-91-0 |
| EINECS: | 200-354-8 |
| Molecular Formula: | C18H24O2 |
| Molecular Weight: | 272.38196 |
| InChI: | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17-,18+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.17 g/cm3 |
| Refractive index: | 1.599 |
| Water Solubility: | ethanol: 50 mg/mL, clear, colorless |
| Solubility: | ethanol: 50 mg/mL, clear, colorless |
| Appearance: | powder |
| Specification: |
The chemical synonyms of 8R,9S,13S,14S,17R)-13-Methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (57-91-0) are 1,3,5-Estratriene-3,17-alpha-diol ; 1,3,5-Estratriene-3,17alpha-diol ; 17Alpha-Oestradiol ; 3,17Alpha-Dihydroxyestra-1,3,5(10)-triene ; 3,17-Alpha-dihydroxyoestra-1,3,5(10)-triene ; 3,17Alpha-Dihydroxyoestra-1,3,5(10)-triene ; 5(10)-Triene-3,17-diol,(17-alpha)-estra-3 ; EpiestradiaL .It can treatment dysfunctional uterine bleeding, primary amenorrhea, menopausal syndrome, and so on. |
| Biological Activity: | Endogenous estrogen receptor ligand (K i values are 0.2 and 1.2 nM for ER α and ER β receptors respectively). |
| Color: | white with slight yellow cast |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
